C10H8Cl3N3O2S — CID 3509432
N-[2,2,2-trichloro-1-(1,3-thiazol-2-ylamino)ethyl]furan-2-carboxamide (PubChem CID 3509432) has the molecular formula C10H8Cl3N3O2S and a molecular weight of 340.62 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(1,3-thiazol-2-ylamino)ethyl]furan-2-carboxamide.
| Compound Name | N-[2,2,2-trichloro-1-(1,3-thiazol-2-ylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3509432 |
| Molecular Formula | C10H8Cl3N3O2S |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 338.94 |
| IUPAC Name | N-[2,2,2-trichloro-1-(1,3-thiazol-2-ylamino)ethyl]furan-2-carboxamide |
| SMILES | O=C(NC(Nc1nccs1)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C10H8Cl3N3O2S/c11-10(12,13)8(16-9-14-3-5-19-9)15-7(17)6-2-1-4-18-6/h1-5,8H,(H,14,16)(H,15,17) |
| InChIKey | WOSDTBUTDFSIME-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|