C11H12N2O2S — CID 110470912
N-[2-(1,3-thiazol-2-yl)propan-2-yl]furan-2-carboxamide (PubChem CID 110470912) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-2-yl)propan-2-yl]furan-2-carboxamide.
| Compound Name | N-[2-(1,3-thiazol-2-yl)propan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110470912 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | N-[2-(1,3-thiazol-2-yl)propan-2-yl]furan-2-carboxamide |
| SMILES | CC(C)(NC(=O)c1ccco1)c1nccs1 |
| InChI | InChI=1S/C11H12N2O2S/c1-11(2,10-12-5-7-16-10)13-9(14)8-4-3-6-15-8/h3-7H,1-2H3,(H,13,14) |
| InChIKey | VPRWIZZIJZWGDX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |