C11H11BrN2O2S — CID 107091806
2-bromo-N-[2-(1,3-thiazol-2-yl)propan-2-yl]furan-3-carboxamide (PubChem CID 107091806) has the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. Its IUPAC name is 2-bromo-N-[2-(1,3-thiazol-2-yl)propan-2-yl]furan-3-carboxamide.
| Compound Name | 2-bromo-N-[2-(1,3-thiazol-2-yl)propan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 107091806 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 2-bromo-N-[2-(1,3-thiazol-2-yl)propan-2-yl]furan-3-carboxamide |
| SMILES | CC(C)(NC(=O)c1ccoc1Br)c1nccs1 |
| InChI | InChI=1S/C11H11BrN2O2S/c1-11(2,10-13-4-6-17-10)14-9(15)7-3-5-16-8(7)12/h3-6H,1-2H3,(H,14,15) |
| InChIKey | SNEPSMPIXJJQQG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |