C18H18N4O3S2 — CID 86962252
4-(pyridin-4-ylsulfamoyl)-N-[2-(1,3-thiazol-2-yl)propan-2-yl]benzamide (PubChem CID 86962252) has the molecular formula C18H18N4O3S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-(pyridin-4-ylsulfamoyl)-N-[2-(1,3-thiazol-2-yl)propan-2-yl]benzamide.
| Compound Name | 4-(pyridin-4-ylsulfamoyl)-N-[2-(1,3-thiazol-2-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 86962252 |
| Molecular Formula | C18H18N4O3S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 4-(pyridin-4-ylsulfamoyl)-N-[2-(1,3-thiazol-2-yl)propan-2-yl]benzamide |
| SMILES | CC(C)(NC(=O)c1ccc(S(=O)(=O)Nc2ccncc2)cc1)c1nccs1 |
| InChI | InChI=1S/C18H18N4O3S2/c1-18(2,17-20-11-12-26-17)21-16(23)13-3-5-15(6-4-13)27(24,25)22-14-7-9-19-10-8-14/h3-12H,1-2H3,(H,19,22)(H,21,23) |
| InChIKey | BYBGNRYQTYVDSI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |