C18H20N2O6 — CID 9404731
methyl (2R)-2-[3-(furan-2-carbonylamino)propanoylamino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 9404731) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl (2R)-2-[3-(furan-2-carbonylamino)propanoylamino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2R)-2-[3-(furan-2-carbonylamino)propanoylamino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 9404731 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | methyl (2R)-2-[3-(furan-2-carbonylamino)propanoylamino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)CCNC(=O)c1ccco1 |
| InChI | InChI=1S/C18H20N2O6/c1-25-18(24)14(11-12-4-6-13(21)7-5-12)20-16(22)8-9-19-17(23)15-3-2-10-26-15/h2-7,10,14,21H,8-9,11H2,1H3,(H,19,23)(H,20,22)/t14-/m1/s1 |
| InChIKey | VUDSXPAITJWUHA-CQSZACIVSA-N |
| XLogP | 1.01 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |