C22H27N3O3 — CID 91500084
3-N-benzyl-1-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 91500084) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-N-benzyl-1-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 3-N-benzyl-1-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 91500084 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-N-benzyl-1-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCNC(=O)c1cc(C(N)=O)cc(C(=O)N(CCC)Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H27N3O3/c1-3-10-24-21(27)18-12-17(20(23)26)13-19(14-18)22(28)25(11-4-2)15-16-8-6-5-7-9-16/h5-9,12-14H,3-4,10-11,15H2,1-2H3,(H2,23,26)(H,24,27) |
| InChIKey | OXEWUWXFYMKVHT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |