C18H22N2O2 — CID 42845893
5-(3,5-dimethylphenyl)-N-(3-methoxypropyl)pyridine-3-carboxamide (PubChem CID 42845893) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-(3,5-dimethylphenyl)-N-(3-methoxypropyl)pyridine-3-carboxamide.
| Compound Name | 5-(3,5-dimethylphenyl)-N-(3-methoxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42845893 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 5-(3,5-dimethylphenyl)-N-(3-methoxypropyl)pyridine-3-carboxamide |
| SMILES | COCCCNC(=O)c1cncc(-c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C18H22N2O2/c1-13-7-14(2)9-15(8-13)16-10-17(12-19-11-16)18(21)20-5-4-6-22-3/h7-12H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | HGXOUZIHAAQPDC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|