C13H20N2O2S — CID 113487169
3-(2-aminoethyl)-N-(3-methylsulfinylpropyl)benzamide (PubChem CID 113487169) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-(2-aminoethyl)-N-(3-methylsulfinylpropyl)benzamide.
| Compound Name | 3-(2-aminoethyl)-N-(3-methylsulfinylpropyl)benzamide |
|---|---|
| PubChem CID | 113487169 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-(2-aminoethyl)-N-(3-methylsulfinylpropyl)benzamide |
| SMILES | CS(=O)CCCNC(=O)c1cccc(CCN)c1 |
| InChI | InChI=1S/C13H20N2O2S/c1-18(17)9-3-8-15-13(16)12-5-2-4-11(10-12)6-7-14/h2,4-5,10H,3,6-9,14H2,1H3,(H,15,16) |
| InChIKey | GJXSQNZKBYBMOS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|