C11H13BrFNOS — CID 115679118
2-bromo-6-fluoro-N-(3-methylsulfanylpropyl)benzamide (PubChem CID 115679118) has the molecular formula C11H13BrFNOS and a molecular weight of 306.20 g/mol. Its IUPAC name is 2-bromo-6-fluoro-N-(3-methylsulfanylpropyl)benzamide.
| Compound Name | 2-bromo-6-fluoro-N-(3-methylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 115679118 |
| Molecular Formula | C11H13BrFNOS |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 2-bromo-6-fluoro-N-(3-methylsulfanylpropyl)benzamide |
| SMILES | CSCCCNC(=O)c1c(F)cccc1Br |
| InChI | InChI=1S/C11H13BrFNOS/c1-16-7-3-6-14-11(15)10-8(12)4-2-5-9(10)13/h2,4-5H,3,6-7H2,1H3,(H,14,15) |
| InChIKey | BAYYPCKHXXYXJU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|