C11H15FN2OS — CID 63980672
4-amino-2-fluoro-N-(3-methylsulfanylpropyl)benzamide (PubChem CID 63980672) has the molecular formula C11H15FN2OS and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-amino-2-fluoro-N-(3-methylsulfanylpropyl)benzamide.
| Compound Name | 4-amino-2-fluoro-N-(3-methylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 63980672 |
| Molecular Formula | C11H15FN2OS |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-amino-2-fluoro-N-(3-methylsulfanylpropyl)benzamide |
| SMILES | CSCCCNC(=O)c1ccc(N)cc1F |
| InChI | InChI=1S/C11H15FN2OS/c1-16-6-2-5-14-11(15)9-4-3-8(13)7-10(9)12/h3-4,7H,2,5-6,13H2,1H3,(H,14,15) |
| InChIKey | QUFJJZUSRJIWFZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|