C16H15BrFNO — CID 115678122
2-bromo-6-fluoro-N-(3-phenylpropyl)benzamide (PubChem CID 115678122) has the molecular formula C16H15BrFNO and a molecular weight of 336.20 g/mol. Its IUPAC name is 2-bromo-6-fluoro-N-(3-phenylpropyl)benzamide.
| Compound Name | 2-bromo-6-fluoro-N-(3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 115678122 |
| Molecular Formula | C16H15BrFNO |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-bromo-6-fluoro-N-(3-phenylpropyl)benzamide |
| SMILES | O=C(NCCCc1ccccc1)c1c(F)cccc1Br |
| InChI | InChI=1S/C16H15BrFNO/c17-13-9-4-10-14(18)15(13)16(20)19-11-5-8-12-6-2-1-3-7-12/h1-4,6-7,9-10H,5,8,11H2,(H,19,20) |
| InChIKey | SIAPZLQCRCJESC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|