C15H15BrN2O — CID 107517966
3-bromo-N-(3-phenylpropyl)pyridine-2-carboxamide (PubChem CID 107517966) has the molecular formula C15H15BrN2O and a molecular weight of 319.20 g/mol. Its IUPAC name is 3-bromo-N-(3-phenylpropyl)pyridine-2-carboxamide.
| Compound Name | 3-bromo-N-(3-phenylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107517966 |
| Molecular Formula | C15H15BrN2O |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3-bromo-N-(3-phenylpropyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1ncccc1Br |
| InChI | InChI=1S/C15H15BrN2O/c16-13-9-5-10-17-14(13)15(19)18-11-4-8-12-6-2-1-3-7-12/h1-3,5-7,9-10H,4,8,11H2,(H,18,19) |
| InChIKey | KLTNWYZYSXKGEU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|