C12H17ClN2O — CID 64570115
6-chloro-N-(2,3-dimethylbutyl)pyridine-2-carboxamide (PubChem CID 64570115) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 6-chloro-N-(2,3-dimethylbutyl)pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(2,3-dimethylbutyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 64570115 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 6-chloro-N-(2,3-dimethylbutyl)pyridine-2-carboxamide |
| SMILES | CC(C)C(C)CNC(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C12H17ClN2O/c1-8(2)9(3)7-14-12(16)10-5-4-6-11(13)15-10/h4-6,8-9H,7H2,1-3H3,(H,14,16) |
| InChIKey | YUZMNQWPEJFFHZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|