C11H16ClN3O — CID 106551385
6-chloro-N-(2,3-dimethylbutyl)pyrazine-2-carboxamide (PubChem CID 106551385) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is 6-chloro-N-(2,3-dimethylbutyl)pyrazine-2-carboxamide.
| Compound Name | 6-chloro-N-(2,3-dimethylbutyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 106551385 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 6-chloro-N-(2,3-dimethylbutyl)pyrazine-2-carboxamide |
| SMILES | CC(C)C(C)CNC(=O)c1cncc(Cl)n1 |
| InChI | InChI=1S/C11H16ClN3O/c1-7(2)8(3)4-14-11(16)9-5-13-6-10(12)15-9/h5-8H,4H2,1-3H3,(H,14,16) |
| InChIKey | KOFPIQGLUVPAOG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |