C15H11FN4O — CID 110851225
N-[(2-fluorophenyl)methyl]pyrido[2,3-b]pyrazine-7-carboxamide (PubChem CID 110851225) has the molecular formula C15H11FN4O and a molecular weight of 282.28 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]pyrido[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]pyrido[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 110851225 |
| Molecular Formula | C15H11FN4O |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]pyrido[2,3-b]pyrazine-7-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1cnc2nccnc2c1 |
| InChI | InChI=1S/C15H11FN4O/c16-12-4-2-1-3-10(12)8-20-15(21)11-7-13-14(19-9-11)18-6-5-17-13/h1-7,9H,8H2,(H,20,21) |
| InChIKey | UXILYFDQZGCOJW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |