C17H17N3O2 — CID 56866391
[(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-(1,8-naphthyridin-2-yl)methanone (PubChem CID 56866391) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is [(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-(1,8-naphthyridin-2-yl)methanone.
| Compound Name | [(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-(1,8-naphthyridin-2-yl)methanone |
|---|---|
| PubChem CID | 56866391 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | [(3aR,4R,7S,7aS)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl]-(1,8-naphthyridin-2-yl)methanone |
| SMILES | O=C(c1ccc2cccnc2n1)N1C[C@@H]2[C@H](C1)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C17H17N3O2/c21-17(13-4-3-10-2-1-7-18-16(10)19-13)20-8-11-12(9-20)15-6-5-14(11)22-15/h1-4,7,11-12,14-15H,5-6,8-9H2/t11-,12+,14+,15- |
| InChIKey | ZISHQBUTPASBEZ-IKARSPCKSA-N |
| XLogP | 1.88 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |