C21H24N4O2 — CID 167811149
1-[(3aR,6aS)-2-(1,8-naphthyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopropylpropan-1-one (PubChem CID 167811149) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-(1,8-naphthyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopropylpropan-1-one.
| Compound Name | 1-[(3aR,6aS)-2-(1,8-naphthyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopropylpropan-1-one |
|---|---|
| PubChem CID | 167811149 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-[(3aR,6aS)-2-(1,8-naphthyridine-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-cyclopropylpropan-1-one |
| SMILES | CC(C(=O)N1C[C@H]2CN(C(=O)c3ccc4cccnc4n3)C[C@H]2C1)C1CC1 |
| InChI | InChI=1S/C21H24N4O2/c1-13(14-4-5-14)20(26)24-9-16-11-25(12-17(16)10-24)21(27)18-7-6-15-3-2-8-22-19(15)23-18/h2-3,6-8,13-14,16-17H,4-5,9-12H2,1H3/t13?,16-,17+ |
| InChIKey | WAXRJUFBADFYOK-FUCXHRTASA-N |
| XLogP | 2.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |