About CID 177046981
CID 177046981 (PubChem CID 177046981) has the molecular formula C8H5N2Sn
and a molecular weight of 247.85 g/mol.
Molecular Properties
| Compound Name | CID 177046981 |
| PubChem CID | 177046981 |
| Molecular Formula | C8H5N2Sn |
| Molecular Weight | 247.85 g/mol |
| Exact Mass | 248.95 |
| IUPAC Name | — |
| SMILES | [Sn]c1ccc2cccnc2n1 |
| InChI | InChI=1S/C8H5N2.Sn/c1-3-7-4-2-6-10-8(7)9-5-1;/h1-5H; |
| InChIKey | YHIAWYLMABTFJJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.85 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 177046981 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177046981?
The IUPAC name of CID 177046981 (CID 177046981) is not available.
What is the SMILES notation for CID 177046981?
The canonical SMILES for CID 177046981 is [Sn]c1ccc2cccnc2n1.
What is the InChIKey of CID 177046981?
The InChIKey is YHIAWYLMABTFJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N2.Sn/c1-3-7-4-2-6-10-8(7)9-5-1;/h1-5H;.
What are the key properties of CID 177046981?
CID 177046981 has a molecular weight of 247.85 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177046981 is sourced from PubChem (CID 177046981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).