About N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine
N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine (PubChem CID 45117995) has the molecular formula C16H11N5
and a molecular weight of 273.30 g/mol. Its IUPAC name is N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine.
Molecular Properties
| Compound Name | N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine |
| PubChem CID | 45117995 |
| Molecular Formula | C16H11N5 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine |
| SMILES | c1cnc2nc(Nc3ccc4cccnc4n3)ccc2c1 |
| InChI | InChI=1S/C16H11N5/c1-3-11-5-7-13(20-15(11)17-9-1)19-14-8-6-12-4-2-10-18-16(12)21-14/h1-10H,(H,17,18,19,20,21) |
| InChIKey | WHWJUDAUINHLTE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine?
The IUPAC name of N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine (CID 45117995) is N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine.
What is the SMILES notation for N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine?
The canonical SMILES for N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine is c1cnc2nc(Nc3ccc4cccnc4n3)ccc2c1.
What is the InChIKey of N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine?
The InChIKey is WHWJUDAUINHLTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N5/c1-3-11-5-7-13(20-15(11)17-9-1)19-14-8-6-12-4-2-10-18-16(12)21-14/h1-10H,(H,17,18,19,20,21).
What are the key properties of N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine?
N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine has a molecular weight of 273.30 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine is sourced from PubChem (CID 45117995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).