C16H11N5 — CID 45117995
N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine (PubChem CID 45117995) has the molecular formula C16H11N5 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine.
| Compound Name | N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 45117995 |
| Molecular Formula | C16H11N5 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-(1,8-naphthyridin-2-yl)-1,8-naphthyridin-2-amine |
| SMILES | c1cnc2nc(Nc3ccc4cccnc4n3)ccc2c1 |
| InChI | InChI=1S/C16H11N5/c1-3-11-5-7-13(20-15(11)17-9-1)19-14-8-6-12-4-2-10-18-16(12)21-14/h1-10H,(H,17,18,19,20,21) |
| InChIKey | WHWJUDAUINHLTE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |