C8H6N4NaO+ — CID 54607944
sodium N-(1,8-naphthyridin-2-yl)nitrous amide (PubChem CID 54607944) has the molecular formula C8H6N4NaO+ and a molecular weight of 197.15 g/mol. Its IUPAC name is sodium N-(1,8-naphthyridin-2-yl)nitrous amide.
| Compound Name | sodium N-(1,8-naphthyridin-2-yl)nitrous amide |
|---|---|
| PubChem CID | 54607944 |
| Molecular Formula | C8H6N4NaO+ |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | sodium N-(1,8-naphthyridin-2-yl)nitrous amide |
| SMILES | O=NNc1ccc2cccnc2n1.[Na+] |
| InChI | InChI=1S/C8H6N4O.Na/c13-12-11-7-4-3-6-2-1-5-9-8(6)10-7;/h1-5H,(H,9,10,11,13);/q;+1 |
| InChIKey | WBERYNONSKRSTM-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|