C20H13ClN4O — CID 177047263
6-(4-chlorophenyl)-N-(1,8-naphthyridin-2-yl)pyridine-3-carboxamide (PubChem CID 177047263) has the molecular formula C20H13ClN4O and a molecular weight of 360.80 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(1,8-naphthyridin-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-N-(1,8-naphthyridin-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 177047263 |
| Molecular Formula | C20H13ClN4O |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(1,8-naphthyridin-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2cccnc2n1)c1ccc(-c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C20H13ClN4O/c21-16-7-3-13(4-8-16)17-9-5-15(12-23-17)20(26)25-18-10-6-14-2-1-11-22-19(14)24-18/h1-12H,(H,22,24,25,26) |
| InChIKey | XJWOHSSBKZSMRV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |