C23H18N4O — CID 177047597
6-(4-cyclopropylphenyl)-N-(1,8-naphthyridin-2-yl)pyridine-3-carboxamide (PubChem CID 177047597) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is 6-(4-cyclopropylphenyl)-N-(1,8-naphthyridin-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-(4-cyclopropylphenyl)-N-(1,8-naphthyridin-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 177047597 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 6-(4-cyclopropylphenyl)-N-(1,8-naphthyridin-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2cccnc2n1)c1ccc(-c2ccc(C3CC3)cc2)nc1 |
| InChI | InChI=1S/C23H18N4O/c28-23(27-21-12-10-18-2-1-13-24-22(18)26-21)19-9-11-20(25-14-19)17-7-5-16(6-8-17)15-3-4-15/h1-2,5-15H,3-4H2,(H,24,26,27,28) |
| InChIKey | YQTIQJXUOHOWSA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |