C11H7N5 — CID 123157020
2-pyrimidin-5-ylpyrido[2,3-d]pyrimidine (PubChem CID 123157020) has the molecular formula C11H7N5 and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-pyrimidin-5-ylpyrido[2,3-d]pyrimidine.
| Compound Name | 2-pyrimidin-5-ylpyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 123157020 |
| Molecular Formula | C11H7N5 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-pyrimidin-5-ylpyrido[2,3-d]pyrimidine |
| SMILES | c1cnc2nc(-c3cncnc3)ncc2c1 |
| InChI | InChI=1S/C11H7N5/c1-2-8-6-15-11(16-10(8)14-3-1)9-4-12-7-13-5-9/h1-7H |
| InChIKey | VQOHRULOMWTKML-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |