C12H9N3S — CID 141003087
2-(5-methylthiophen-2-yl)pyrido[2,3-d]pyrimidine (PubChem CID 141003087) has the molecular formula C12H9N3S and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-(5-methylthiophen-2-yl)pyrido[2,3-d]pyrimidine.
| Compound Name | 2-(5-methylthiophen-2-yl)pyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 141003087 |
| Molecular Formula | C12H9N3S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-(5-methylthiophen-2-yl)pyrido[2,3-d]pyrimidine |
| SMILES | Cc1ccc(-c2ncc3cccnc3n2)s1 |
| InChI | InChI=1S/C12H9N3S/c1-8-4-5-10(16-8)12-14-7-9-3-2-6-13-11(9)15-12/h2-7H,1H3 |
| InChIKey | JPPADPPDFMDEGU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |