C21H33F2N3O3 — CID 158657206
(2S)-2-amino-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]butanoic acid (PubChem CID 158657206) has the molecular formula C21H33F2N3O3 and a molecular weight of 413.51 g/mol. Its IUPAC name is (2S)-2-amino-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 158657206 |
| Molecular Formula | C21H33F2N3O3 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | (2S)-2-amino-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]butanoic acid |
| SMILES | N[C@@H](CCN(CCCCc1ccc2c(n1)CCCC2)CCOCC(F)F)C(=O)O |
| InChI | InChI=1S/C21H33F2N3O3/c22-20(23)15-29-14-13-26(12-10-18(24)21(27)28)11-4-3-6-17-9-8-16-5-1-2-7-19(16)25-17/h8-9,18,20H,1-7,10-15,24H2,(H,27,28)/t18-/m0/s1 |
| InChIKey | GUGVSUPIKMEYOA-SFHVURJKSA-N |
| XLogP | 2.67 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|