C26H34N2O3 — CID 157053292
methyl 2-phenyl-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetate (PubChem CID 157053292) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl 2-phenyl-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetate.
| Compound Name | methyl 2-phenyl-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 157053292 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | methyl 2-phenyl-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccccc1)N1CC[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C26H34N2O3/c1-30-26(29)25(21-10-3-2-4-11-21)28-17-16-23(19-28)31-18-8-7-12-22-15-14-20-9-5-6-13-24(20)27-22/h2-4,10-11,14-15,23,25H,5-9,12-13,16-19H2,1H3/t23-,25?/m1/s1 |
| InChIKey | YWTWWERNOHUTRZ-XQZUBTRRSA-N |
| XLogP | 4.29 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|