C28H38N2O2 — CID 158859268
(1R)-1-(4-ethylphenyl)-1-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]propan-2-one (PubChem CID 158859268) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is (1R)-1-(4-ethylphenyl)-1-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]propan-2-one.
| Compound Name | (1R)-1-(4-ethylphenyl)-1-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 158859268 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (1R)-1-(4-ethylphenyl)-1-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]propan-2-one |
| SMILES | CCc1ccc([C@H](C(C)=O)N2CC[C@@H](OCCCCc3ccc4c(n3)CCCC4)C2)cc1 |
| InChI | InChI=1S/C28H38N2O2/c1-3-22-11-13-24(14-12-22)28(21(2)31)30-18-17-26(20-30)32-19-7-6-9-25-16-15-23-8-4-5-10-27(23)29-25/h11-16,26,28H,3-10,17-20H2,1-2H3/t26-,28+/m1/s1 |
| InChIKey | YPONCANQQXVSED-IAPPQJPRSA-N |
| XLogP | 5.27 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|