C30H43FN2O4S2 — CID 158871852
2-[5-fluoro-2-[(2S)-oxan-2-yl]phenyl]-2-[(3S)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid;sulfane (PubChem CID 158871852) has the molecular formula C30H43FN2O4S2 and a molecular weight of 578.82 g/mol. Its IUPAC name is 2-[5-fluoro-2-[(2S)-oxan-2-yl]phenyl]-2-[(3S)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid;sulfane.
| Compound Name | 2-[5-fluoro-2-[(2S)-oxan-2-yl]phenyl]-2-[(3S)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid;sulfane |
|---|---|
| PubChem CID | 158871852 |
| Molecular Formula | C30H43FN2O4S2 |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 2-[5-fluoro-2-[(2S)-oxan-2-yl]phenyl]-2-[(3S)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid;sulfane |
| SMILES | O=C(O)C(c1cc(F)ccc1[C@@H]1CCCCO1)N1CC[C@H](OCCCCc2ccc3c(n2)CCCC3)C1.S.S |
| InChI | InChI=1S/C30H39FN2O4.2H2S/c31-22-12-14-25(28-10-4-6-18-37-28)26(19-22)29(30(34)35)33-16-15-24(20-33)36-17-5-3-8-23-13-11-21-7-1-2-9-27(21)32-23;;/h11-14,19,24,28-29H,1-10,15-18,20H2,(H,34,35);2*1H2/t24-,28-,29?;;/m0../s1 |
| InChIKey | JBYDGSLYVITQGD-UEKBWWPZSA-N |
| XLogP | 5.81 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|