C32H44N2O4 — CID 159346890
(2S)-2-[2-(5,5-dimethyloxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 159346890) has the molecular formula C32H44N2O4 and a molecular weight of 520.71 g/mol. Its IUPAC name is (2S)-2-[2-(5,5-dimethyloxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-[2-(5,5-dimethyloxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 159346890 |
| Molecular Formula | C32H44N2O4 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | (2S)-2-[2-(5,5-dimethyloxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | CC1(C)CCC(c2ccccc2[C@@H](C(=O)O)N2CC[C@@H](OCCCCc3ccc4c(n3)CCCC4)C2)OC1 |
| InChI | InChI=1S/C32H44N2O4/c1-32(2)18-16-29(38-22-32)26-11-4-5-12-27(26)30(31(35)36)34-19-17-25(21-34)37-20-8-7-10-24-15-14-23-9-3-6-13-28(23)33-24/h4-5,11-12,14-15,25,29-30H,3,6-10,13,16-22H2,1-2H3,(H,35,36)/t25-,29?,30+/m1/s1 |
| InChIKey | LOGXYVYMLFCWMC-POFKQXDPSA-N |
| XLogP | 6.08 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|