C26H35N3O3 — CID 175332192
2-(3-ethylphenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 175332192) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 2-(3-ethylphenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(3-ethylphenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 175332192 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 2-(3-ethylphenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | CCc1cccc(C(C(=O)O)N2CC[C@@H](OCCCCc3ccc4c(n3)CCCN4)C2)c1 |
| InChI | InChI=1S/C26H35N3O3/c1-2-19-7-5-8-20(17-19)25(26(30)31)29-15-13-22(18-29)32-16-4-3-9-21-11-12-23-24(28-21)10-6-14-27-23/h5,7-8,11-12,17,22,25,27H,2-4,6,9-10,13-16,18H2,1H3,(H,30,31)/t22-,25?/m1/s1 |
| InChIKey | GLTTZIIDAZDBEB-UFUCKMQHSA-N |
| XLogP | 4.24 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|