C26H33NO3 — CID 159558302
(2S)-2-phenyl-2-[(3R)-3-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 159558302) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is (2S)-2-phenyl-2-[(3R)-3-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-phenyl-2-[(3R)-3-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 159558302 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (2S)-2-phenyl-2-[(3R)-3-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@H](c1ccccc1)N1CC[C@@H](OCCCCc2ccc3c(c2)CCCC3)C1 |
| InChI | InChI=1S/C26H33NO3/c28-26(29)25(22-10-2-1-3-11-22)27-16-15-24(19-27)30-17-7-6-8-20-13-14-21-9-4-5-12-23(21)18-20/h1-3,10-11,13-14,18,24-25H,4-9,12,15-17,19H2,(H,28,29)/t24-,25+/m1/s1 |
| InChIKey | HCVBAMVKSQOEQE-RPBOFIJWSA-N |
| XLogP | 4.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|