C28H38N4O3 — CID 175693863
2-(4-propan-2-yloxyphenyl)-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoic acid (PubChem CID 175693863) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is 2-(4-propan-2-yloxyphenyl)-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoic acid.
| Compound Name | 2-(4-propan-2-yloxyphenyl)-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 175693863 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 2-(4-propan-2-yloxyphenyl)-3-[[(1S,5R)-3-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]propanoic acid |
| SMILES | CC(C)Oc1ccc(C(CNC2[C@H]3CN(CCCc4ccc5c(n4)NCCC5)C[C@@H]23)C(=O)O)cc1 |
| InChI | InChI=1S/C28H38N4O3/c1-18(2)35-22-11-8-19(9-12-22)23(28(33)34)15-30-26-24-16-32(17-25(24)26)14-4-6-21-10-7-20-5-3-13-29-27(20)31-21/h7-12,18,23-26,30H,3-6,13-17H2,1-2H3,(H,29,31)(H,33,34)/t23?,24-,25+,26? |
| InChIKey | HGJIKSAJNCPNKV-WHMVAZNWSA-N |
| XLogP | 3.55 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |