C26H36Cl2N4O3 — CID 165121218
1,3-dichlorobenzene;3-formamidopropanoic acid;7-(3-piperidin-1-ylpropyl)-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 165121218) has the molecular formula C26H36Cl2N4O3 and a molecular weight of 523.51 g/mol. Its IUPAC name is 1,3-dichlorobenzene;3-formamidopropanoic acid;7-(3-piperidin-1-ylpropyl)-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 1,3-dichlorobenzene;3-formamidopropanoic acid;7-(3-piperidin-1-ylpropyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 165121218 |
| Molecular Formula | C26H36Cl2N4O3 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 1,3-dichlorobenzene;3-formamidopropanoic acid;7-(3-piperidin-1-ylpropyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | Clc1cccc(Cl)c1.O=CNCCC(=O)O.c1cc2c(nc1CCCN1CCCCC1)NCCC2 |
| InChI | InChI=1S/C16H25N3.C6H4Cl2.C4H7NO3/c1-2-11-19(12-3-1)13-5-7-15-9-8-14-6-4-10-17-16(14)18-15;7-5-2-1-3-6(8)4-5;6-3-5-2-1-4(7)8/h8-9H,1-7,10-13H2,(H,17,18);1-4H;3H,1-2H2,(H,5,6)(H,7,8) |
| InChIKey | PPXUVDGCHJQTRM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|