C29H40N4O3 — CID 165121202
3-(2,3-dihydro-1H-inden-4-yl)-3-formamidopropanoic acid;7-(3-piperidin-1-ylpropyl)-1,2,3,4-tetrahydro-1,8-naphthyridine (PubChem CID 165121202) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-4-yl)-3-formamidopropanoic acid;7-(3-piperidin-1-ylpropyl)-1,2,3,4-tetrahydro-1,8-naphthyridine.
| Compound Name | 3-(2,3-dihydro-1H-inden-4-yl)-3-formamidopropanoic acid;7-(3-piperidin-1-ylpropyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 165121202 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-4-yl)-3-formamidopropanoic acid;7-(3-piperidin-1-ylpropyl)-1,2,3,4-tetrahydro-1,8-naphthyridine |
| SMILES | O=CNC(CC(=O)O)c1cccc2c1CCC2.c1cc2c(nc1CCCN1CCCCC1)NCCC2 |
| InChI | InChI=1S/C16H25N3.C13H15NO3/c1-2-11-19(12-3-1)13-5-7-15-9-8-14-6-4-10-17-16(14)18-15;15-8-14-12(7-13(16)17)11-6-2-4-9-3-1-5-10(9)11/h8-9H,1-7,10-13H2,(H,17,18);2,4,6,8,12H,1,3,5,7H2,(H,14,15)(H,16,17) |
| InChIKey | VKFBDUOIUVTAES-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|