C22H22Cl2N6O3 — CID 139414470
(3S)-3-(3,5-dichlorophenyl)-3-[[2-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]triazole-4-carbonyl]amino]propanoic acid (PubChem CID 139414470) has the molecular formula C22H22Cl2N6O3 and a molecular weight of 489.36 g/mol. Its IUPAC name is (3S)-3-(3,5-dichlorophenyl)-3-[[2-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]triazole-4-carbonyl]amino]propanoic acid.
| Compound Name | (3S)-3-(3,5-dichlorophenyl)-3-[[2-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]triazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 139414470 |
| Molecular Formula | C22H22Cl2N6O3 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | (3S)-3-(3,5-dichlorophenyl)-3-[[2-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]triazole-4-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1cnn(CCc2ccc3c(n2)NCCC3)n1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H22Cl2N6O3/c23-15-8-14(9-16(24)10-15)18(11-20(31)32)28-22(33)19-12-26-30(29-19)7-5-17-4-3-13-2-1-6-25-21(13)27-17/h3-4,8-10,12,18H,1-2,5-7,11H2,(H,25,27)(H,28,33)(H,31,32)/t18-/m0/s1 |
| InChIKey | OQDNDMNGSMIMLZ-SFHVURJKSA-N |
| XLogP | 3.53 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |