C22H22Cl2N6O3 — CID 139414252
3-(3,5-dichlorophenyl)-3-[[2-[(2-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)methyl]triazole-4-carbonyl]amino]propanoic acid (PubChem CID 139414252) has the molecular formula C22H22Cl2N6O3 and a molecular weight of 489.36 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-[[2-[(2-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)methyl]triazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-3-[[2-[(2-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)methyl]triazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 139414252 |
| Molecular Formula | C22H22Cl2N6O3 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-[[2-[(2-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-3-yl)methyl]triazole-4-carbonyl]amino]propanoic acid |
| SMILES | Cc1nc2c(cc1Cn1ncc(C(=O)NC(CC(=O)O)c3cc(Cl)cc(Cl)c3)n1)CCCN2 |
| InChI | InChI=1S/C22H22Cl2N6O3/c1-12-15(5-13-3-2-4-25-21(13)27-12)11-30-26-10-19(29-30)22(33)28-18(9-20(31)32)14-6-16(23)8-17(24)7-14/h5-8,10,18H,2-4,9,11H2,1H3,(H,25,27)(H,28,33)(H,31,32) |
| InChIKey | XKLDVYPXJZNMOC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |