C29H35N5O4 — CID 10118707
[[2-[2-oxo-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino] 5-(1H-indol-3-yl)pentanoate (PubChem CID 10118707) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is [[2-[2-oxo-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino] 5-(1H-indol-3-yl)pentanoate.
| Compound Name | [[2-[2-oxo-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino] 5-(1H-indol-3-yl)pentanoate |
|---|---|
| PubChem CID | 10118707 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | [[2-[2-oxo-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]acetyl]amino] 5-(1H-indol-3-yl)pentanoate |
| SMILES | O=C(CN1CCC(CCc2ccc3c(n2)NCCC3)C1=O)NOC(=O)CCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H35N5O4/c35-26(33-38-27(36)10-4-1-6-22-18-31-25-9-3-2-8-24(22)25)19-34-17-15-21(29(34)37)12-14-23-13-11-20-7-5-16-30-28(20)32-23/h2-3,8-9,11,13,18,21,31H,1,4-7,10,12,14-17,19H2,(H,30,32)(H,33,35) |
| InChIKey | XULNRWNWYFOACO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|