C26H35N3O2 — CID 174982010
[2-phenyl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl] propanoate (PubChem CID 174982010) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is [2-phenyl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl] propanoate.
| Compound Name | [2-phenyl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl] propanoate |
|---|---|
| PubChem CID | 174982010 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | [2-phenyl-3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]pyrrolidin-1-yl] propanoate |
| SMILES | CCC(=O)ON1CCC(CCCCCc2ccc3c(n2)NCCC3)C1c1ccccc1 |
| InChI | InChI=1S/C26H35N3O2/c1-2-24(30)31-29-19-17-21(25(29)20-10-5-3-6-11-20)12-7-4-8-14-23-16-15-22-13-9-18-27-26(22)28-23/h3,5-6,10-11,15-16,21,25H,2,4,7-9,12-14,17-19H2,1H3,(H,27,28) |
| InChIKey | WRVRUPVBWGCMFO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|