C12H13NO2 — CID 117291443
3-(3-methyl-1,2-benzoxazol-6-yl)butanal (PubChem CID 117291443) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(3-methyl-1,2-benzoxazol-6-yl)butanal.
| Compound Name | 3-(3-methyl-1,2-benzoxazol-6-yl)butanal |
|---|---|
| PubChem CID | 117291443 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-(3-methyl-1,2-benzoxazol-6-yl)butanal |
| SMILES | Cc1noc2cc(C(C)CC=O)ccc12 |
| InChI | InChI=1S/C12H13NO2/c1-8(5-6-14)10-3-4-11-9(2)13-15-12(11)7-10/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | XICRXZFPCCIKHG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|