C11H13N3OS — CID 17015087
N-butyl-1,2,3-benzothiadiazole-6-carboxamide (PubChem CID 17015087) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is N-butyl-1,2,3-benzothiadiazole-6-carboxamide.
| Compound Name | N-butyl-1,2,3-benzothiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 17015087 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-butyl-1,2,3-benzothiadiazole-6-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2nnsc2c1 |
| InChI | InChI=1S/C11H13N3OS/c1-2-3-6-12-11(15)8-4-5-9-10(7-8)16-14-13-9/h4-5,7H,2-3,6H2,1H3,(H,12,15) |
| InChIKey | OXVMOZSUYVQIDK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|