C7H3ClN2OS — CID 154106567
1,2,3-benzothiadiazole-6-carbonyl chloride (PubChem CID 154106567) has the molecular formula C7H3ClN2OS and a molecular weight of 198.63 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole-6-carbonyl chloride.
| Compound Name | 1,2,3-benzothiadiazole-6-carbonyl chloride |
|---|---|
| PubChem CID | 154106567 |
| Molecular Formula | C7H3ClN2OS |
| Molecular Weight | 198.63 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | 1,2,3-benzothiadiazole-6-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2nnsc2c1 |
| InChI | InChI=1S/C7H3ClN2OS/c8-7(11)4-1-2-5-6(3-4)12-10-9-5/h1-3H |
| InChIKey | ZABSREZSXGXTRV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.63 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|