C7H4FN3OS — CID 140661802
4-fluoro-1,2,3-benzothiadiazole-6-carboxamide (PubChem CID 140661802) has the molecular formula C7H4FN3OS and a molecular weight of 197.19 g/mol. Its IUPAC name is 4-fluoro-1,2,3-benzothiadiazole-6-carboxamide.
| Compound Name | 4-fluoro-1,2,3-benzothiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 140661802 |
| Molecular Formula | C7H4FN3OS |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 4-fluoro-1,2,3-benzothiadiazole-6-carboxamide |
| SMILES | NC(=O)c1cc(F)c2nnsc2c1 |
| InChI | InChI=1S/C7H4FN3OS/c8-4-1-3(7(9)12)2-5-6(4)10-11-13-5/h1-2H,(H2,9,12) |
| InChIKey | ZDXINDHMRJKXPU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |