C7H5N3OS — CID 54111767
1,2,3-benzothiadiazole-4-carboxamide (PubChem CID 54111767) has the molecular formula C7H5N3OS and a molecular weight of 179.20 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole-4-carboxamide.
| Compound Name | 1,2,3-benzothiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 54111767 |
| Molecular Formula | C7H5N3OS |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 1,2,3-benzothiadiazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2snnc12 |
| InChI | InChI=1S/C7H5N3OS/c8-7(11)4-2-1-3-5-6(4)9-10-12-5/h1-3H,(H2,8,11) |
| InChIKey | NHPZGJNCBBVUHW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |