C8H6N2OS2 — CID 18427359
4-methyl-1,2,3-benzothiadiazole-7-carbothioic S-acid (PubChem CID 18427359) has the molecular formula C8H6N2OS2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-methyl-1,2,3-benzothiadiazole-7-carbothioic S-acid.
| Compound Name | 4-methyl-1,2,3-benzothiadiazole-7-carbothioic S-acid |
|---|---|
| PubChem CID | 18427359 |
| Molecular Formula | C8H6N2OS2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 4-methyl-1,2,3-benzothiadiazole-7-carbothioic S-acid |
| SMILES | Cc1ccc(C(=O)S)c2snnc12 |
| InChI | InChI=1S/C8H6N2OS2/c1-4-2-3-5(8(11)12)7-6(4)9-10-13-7/h2-3H,1H3,(H,11,12) |
| InChIKey | ODZLRQYEIWTUEH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|