C7H4N2OS — CID 14855317
1,2,3-benzothiadiazole-4-carbaldehyde (PubChem CID 14855317) has the molecular formula C7H4N2OS and a molecular weight of 164.19 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole-4-carbaldehyde.
| Compound Name | 1,2,3-benzothiadiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 14855317 |
| Molecular Formula | C7H4N2OS |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | 1,2,3-benzothiadiazole-4-carbaldehyde |
| SMILES | O=Cc1cccc2snnc12 |
| InChI | InChI=1S/C7H4N2OS/c10-4-5-2-1-3-6-7(5)8-9-11-6/h1-4H |
| InChIKey | LKMLPKOIPUNVKG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|