C11H12N2OS — CID 90690804
1-(1,2,3-benzothiadiazol-6-yl)-2-methylbutan-1-one (PubChem CID 90690804) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-(1,2,3-benzothiadiazol-6-yl)-2-methylbutan-1-one.
| Compound Name | 1-(1,2,3-benzothiadiazol-6-yl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 90690804 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 1-(1,2,3-benzothiadiazol-6-yl)-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)c1ccc2nnsc2c1 |
| InChI | InChI=1S/C11H12N2OS/c1-3-7(2)11(14)8-4-5-9-10(6-8)15-13-12-9/h4-7H,3H2,1-2H3 |
| InChIKey | XZQROGYWTMJPEQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |