C12H10N2O2S — CID 18989134
1-(1,2,3-benzothiadiazol-5-yl)-3-cyclopropylpropane-1,3-dione (PubChem CID 18989134) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is 1-(1,2,3-benzothiadiazol-5-yl)-3-cyclopropylpropane-1,3-dione.
| Compound Name | 1-(1,2,3-benzothiadiazol-5-yl)-3-cyclopropylpropane-1,3-dione |
|---|---|
| PubChem CID | 18989134 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-(1,2,3-benzothiadiazol-5-yl)-3-cyclopropylpropane-1,3-dione |
| SMILES | O=C(CC(=O)C1CC1)c1ccc2snnc2c1 |
| InChI | InChI=1S/C12H10N2O2S/c15-10(7-1-2-7)6-11(16)8-3-4-12-9(5-8)13-14-17-12/h3-5,7H,1-2,6H2 |
| InChIKey | BFPWRXYJBWRNBG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|