C10H9N3OS — CID 3149527
N-prop-2-enyl-1,2,3-benzothiadiazole-5-carboxamide (PubChem CID 3149527) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is N-prop-2-enyl-1,2,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-prop-2-enyl-1,2,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 3149527 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | N-prop-2-enyl-1,2,3-benzothiadiazole-5-carboxamide |
| SMILES | C=CCNC(=O)c1ccc2snnc2c1 |
| InChI | InChI=1S/C10H9N3OS/c1-2-5-11-10(14)7-3-4-9-8(6-7)12-13-15-9/h2-4,6H,1,5H2,(H,11,14) |
| InChIKey | AXXBQSGEEHXXAB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|