C17H14N4OS — CID 6620476
N-[2-(1H-indol-2-yl)ethyl]-1,2,3-benzothiadiazole-5-carboxamide (PubChem CID 6620476) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[2-(1H-indol-2-yl)ethyl]-1,2,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-[2-(1H-indol-2-yl)ethyl]-1,2,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 6620476 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[2-(1H-indol-2-yl)ethyl]-1,2,3-benzothiadiazole-5-carboxamide |
| SMILES | O=C(NCCc1cc2ccccc2[nH]1)c1ccc2snnc2c1 |
| InChI | InChI=1S/C17H14N4OS/c22-17(12-5-6-16-15(10-12)20-21-23-16)18-8-7-13-9-11-3-1-2-4-14(11)19-13/h1-6,9-10,19H,7-8H2,(H,18,22) |
| InChIKey | KJXHDUFCCMCKBY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |