C18H22N4OS — CID 71913118
1-[2-(1H-indol-2-yl)ethyl]-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]urea (PubChem CID 71913118) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 1-[2-(1H-indol-2-yl)ethyl]-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-[2-(1H-indol-2-yl)ethyl]-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 71913118 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-[2-(1H-indol-2-yl)ethyl]-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]urea |
| SMILES | Cc1csc(CCCNC(=O)NCCc2cc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C18H22N4OS/c1-13-12-24-17(21-13)7-4-9-19-18(23)20-10-8-15-11-14-5-2-3-6-16(14)22-15/h2-3,5-6,11-12,22H,4,7-10H2,1H3,(H2,19,20,23) |
| InChIKey | VDPFNHRWDVSLMT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|